If you are interested in our products, please kindly inquiry us at email: info@leader-biogroup.com
| Product Name: | Polyvinylpyrrolidone |
| Synonyms: | toxobin;vinisil;vinylpyrrolidinonepolymer;vinylpyrrolidonepolymer;PVP K30 USP24;PVP K120;K30 PVP K30;K 30 POVIDONE K 30 BP/USP |
| CAS: | 9003-39-8 |
| MF: | CH4 |
| MW: | 16.04246 |
| EINECS: | 1312995-182-4 |
| Product Categories: | pharmaceutical intermediate and medicine grade;medicinal new accessories;Hydrophobic Polymers;Materials Science;Poly(vinylpyrrolidone);Polymer Science;Polymers;Food & Flavor Additives;Vinylpyridine and Vinypyrrolidone Polymers;API;PVP;9003-39-8;PP;bc0001 |
| Mol File: | 9003-39-8.mol |
 |
|
| Polyvinylpyrrolidone Chemical Properties |
| Melting point | >300 °C |
| Boiling point | 90-93 °C |
| density | 1,69 g/cm3 |
| storage temp. | 2-8°C |
| solubility | H2O: soluble100mg/mL |
| form | powder |
| color | White to yellow-white |
| PH | 3.0-5.0 |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| Merck | 14,7697 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Light sensitive. Hygroscopic. |
| InChI | InChI=1S/C8H15NO/c1-3-7(2)9-6-4-5-8(9)10/h7H,3-6H2,1-2H3 |
| InChIKey | FAAHNQAYWKTLFD-UHFFFAOYSA-N |
| SMILES | N1(C(C)CC)C(=O)CCC1 |
| IARC | 3 (Vol. 19, Sup 7, 71) 1987 |
| EPA Substance Registry System | Polyvinylpyrrolidone (9003-39-8) |
| Safety Information |
| Safety Statements | 22-24/25 |
| WGK Germany | 1 |
| RTECS | TR8370000 |
| Autoignition Temperature | 440 °C |
| TSCA | Yes |
| HS Code | 39059990 |
| Hazardous Substances Data | 9003-39-8(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: > 2000 mg/kg |
