| Product Name: |
Magnesium L-Threonate |
| Synonyms: |
L-Threonic acid magnesium;Magnesium Bis[(2R,3S)-2,3,4-trihydroxybutanoate];Bis[(2R,3S)-2,3,4-trihydroxybutanoato-alphaO,alphaO']magnesium;L-Threonic acid magnesium salt;Magnesium (2R,3S)-2,3,4-trihydroxybutanoate;Magnesium L-threonate;L-Threonate Magnesium;magnesium L-Theorate |
| CAS: |
778571-57-6 |
| MF: |
C8H14MgO10 |
| MW: |
294.5 |
| EINECS: |
1312995-182-4 |
| Product Categories: |
api;778571-57-6 |
| Mol File: |
778571-57-6.mol |
 |
| |
| Magnesium L-Threonate Chemical Properties |
| storage temp. |
Inert atmosphere,Room Temperature |
| form |
Solid |
| color |
White to off-white |
| InChI |
InChI=1S/2C4H8O5.Mg/c2*5-1-2(6)3(7)4(8)9;/h2*2-3,5-7H,1H2,(H,8,9);/q;;+2/p-2 |
| InChIKey |
YVJOHOWNFPQSPP-UHFFFAOYSA-L |
| SMILES |
C(C1=O[Mg+2]2(O=C(C(O)C(O)CO)[O-]2)[O-]1)(O)C(O)CO |
| |
| Magnesium L-Threonate Usage And Synthesis |
| Physical Form |
Solid |
| Description |
L-Threonic acid magnesium salt (Magnesium L-Threonate) is the enantiomer of Threonic acid and a metabolite of vitamin C. L-Ascorbic acid (L-Ascorbate), an electron donor, is an endogenous antioxidant agent. |
| Physical properties |
Appearance:White or almost white powder. |
| Uses |
Magnesium(2+) Ion Bis((2r,3s)-2,3,4-Trihydroxybutanoate) is a useful research chemical. |
| Uses |
Preclinical work demonstrates that L-Threonic Acid Magnesium Salt (LTAMS) administration is associated with neurobiological and neurofunctional effects that could offer clinical benefits in ADHD treatment. |
| Application |
Raw material of healthcare products.A Dietary Supplement.Laboratory research |
| benefits |
Magnesium L-Threonate could enhance cognition, improve body magnesium status, and reduce fluctuation in cognitive ability, brain anti-ageing, and memory improvement. |
|
|