China Largest Manufacturer Factory Supply Hexaphenoxycyclotriphosphazene/Phenoxycycloposphazene(HPCTP) CAS 1184-10-7
Inquiry email: info@leader-biogroup.com
| Phenoxycycloposphazene Basic information |
| Product Name: |
Phenoxycycloposphazene |
| Synonyms: |
Phenoxycycloposphazene;Polyphenoxy phosphazene;2,2,4,4,6,6-Hexahydro-2,2,4,4,6,6-hexaphenoxytriazatriphosphorine;Diphenoxyphosphazene cyclic trimer;FP 100;Hexaphenoxy-1,3,5,2,4,6-triazatriphosphorine;Hexaphenoxycyclotriphosphazatriene;Hexaphenoxycyclotriphosphazene |
| CAS: |
1184-10-7 |
| MF: |
C36H30N3O6P3 |
| MW: |
693.56 |
| EINECS: |
208-127-2 |
| Product Categories: |
fine chemicals;New type of halogen-free flame retardants, used in encapsulation Circuit board base material , resin etc.;flame retardant |
| Mol File: |
1184-10-7.mol |
 |
| |
| Phenoxycycloposphazene Chemical Properties |
| Melting point |
116℃ |
| Boiling point |
280°C/0.1mmHg(lit.) |
| density |
1.31 |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
soluble in Toluene |
| pka |
-12.47±0.50(Predicted) |
| form |
powder to crystal |
| color |
White to Almost white |
| λmax |
261nm(CHCl3)(lit.) |
| InChIKey |
RNFJDJUURJAICM-UHFFFAOYSA-N |
| SMILES |
P1(N=P(N=P(OC2C=CC=CC=2)(OC2C=CC=CC=2)N=1)(OC1C=CC=CC=1)OC1C=CC=CC=1)(OC1C=CC=CC=1)OC1C=CC=CC=1 |
| |
| Phenoxycycloposphazene Usage And Synthesis |
| Description |
Phenoxycycloposphazene (HPCTP), a cyClic phenoxyphosphazene, is a thermally and hydrolytically stable phosphorus-nitrogen flame retardant with favourable electrical properties. Phosphazenes show higher heat distortion temperatures compared to aromatic bisphosphates. |
| Uses |
Hexaphenoxycyclotriphosphazene is a useful research chemical. |
