Inquiry email: info@leader-biogroup.com
Hot Line +86-029-68895030
+86-029-68569961
+86-029-68569962
Fax +86-029-68895030
| product Name |
3-HYDROXYBUTYRIC ACID/Beta-hydroxybutyrate |
| Synonyms |
3-Hydroxybutyric acid; dl-B-hydroxybutyric acid; (3R)-3-hydroxybutanoate; DL-3-Hydroxybutanoic acid |
| Molecular Formula |
C4H8O3 |
| Molecular Weight |
104.1 |
| InChI |
InChI=1/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/p-1/t3-/m1/s1 |
| CAS Registry Number |
300-85-6;625-71-8 |
| Molecular Structure |
|
| Density |
1.126 |
| Boiling point |
118-120℃ (2 mmHg) |
| Refractive index |
1.443 |
| Flash point |
>110℃ |
| Vapour Pressur |
0.000979mmHg at 25°C |
| Hazard Symbols |
Xi:Irritant; |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.; |