Inquiry email: info@leader-biogroup.com
Hot Line +86-029-68895030
+86-029-68569961
+86-029-68569962
Fax +86-029-68895030
| product Name |
L(+)tartaric acid dipotassium |
| Synonyms |
dipotassium tartrate; L-Tartaric acid dipotassium salt; potassium tartrate |
| Molecular Formula |
K2C4H4O6 |
| Molecular Weight |
226.266 |
| InChI |
InChI=1/C4H6O6.2K/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2/t1-,2-;;/m1../s1 |
| CAS Registry Number |
921-53-9 |
| EINECS |
213-067-8 |
| Molecular Structure |
|
| Density |
1.98 |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.; |