| Octenyl succinic anhydride Basic information |
| Product Name: |
Octenyl succinic anhydride |
| Synonyms: |
2-OCTENYLSUCCINIC ANHYDRIDE, 99.9%;Dihydro-3-(Octen-1-Yl)-2,5-Furandione;2,5-Furandione, dihydro-3-(octen-1-yl)-;Einecs 247-899-8;Succinic anhydride, octenyl-;5-Furandione,dihydro-3-(octenyl)-2;dihydro-3-(octenyl)-5-furandione;Milldride OSA |
| CAS: |
26680-54-6 |
| MF: |
C12H18O3 |
| MW: |
210.27 |
| EINECS: |
247-899-8 |
| Product Categories: |
Anhydride Monomers;Monomers;Polymer Science |
| Mol File: |
26680-54-6.mol |
 |
| |
| Octenyl succinic anhydride Chemical Properties |
| Melting point |
8-12 °C(lit.) |
| Boiling point |
168 °C10 mm Hg(lit.) |
| density |
1 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.4694(lit.) |
| Fp |
>230 °F |
| form |
Liquid |
| color |
Colorless to light yellow |
| InChI |
InChI=1S/C12H18O3/c1-2-3-4-5-6-7-8-10-9-11(13)15-12(10)14/h7-8,10H,2-6,9H2,1H3/b8-7+ |
| InChIKey |
FLISWPFVWWWNNP-BQYQJAHWSA-N |
| SMILES |
O=C(C(/C=C/CCCCCC)C1)OC1=O |
| CAS DataBase Reference |
26680-54-6(CAS DataBase Reference) |
| EPA Substance Registry System |
2,5-Furandione, dihydro-3-(octenyl)- (26680-54-6) |
| Hazard Codes |
Xi |
| Risk Statements |
36/38 |
| Safety Statements |
26-36 |
| WGK Germany |
3 |
| |
| Octenyl succinic anhydride Usage And Synthesis |
| Description |
Octenyl succinic anhydride is an important intermediate of fine chemicals. It has high chemical reactivity because its molecules contain carbon-carbon double bonds and carboxylic acid ligands. Under appropriate conditions, a series of reactions such as addition, Chemicalbook substitution, reduction, acetylation, hydrolysis and polymerization can occur, and various derivatives can be synthesized. Alkyd resin can be synthesized by reacting with alcohol, acid amine can be synthesized by reacting with amine, and starch can be modified. |
| Uses |
Octenyl succinic anhydride can be used to esterify starch to yield a hydrocolloid with amphiphilic properties, octenyl succinylated starch (OS-starch). Octenyl succinic anhydride (OSA) modification affects the interaction between molecules on the outer surface of two starch granules by changing the molecular structure of the outer surface |
|
|
|