Inquiry email: info@leader-biogroup.com
Hot Line +86-029-68895030
+86-029-68569961
+86-029-68569962
Fax +86-029-68895030
| product Name |
Dodecyl 4-hydroxybenzoate |
| Synonyms |
4-Hydroxybenzoic acid n-dodecyl ester~Lauryl 4-hydroxybenzoate; dodecyl 4-hydroxybenzoate |
| Molecular Formula |
C19H30O3 |
| Molecular Weight |
306.4397 |
| InChI |
InChI=1/C19H30O3/c1-2-3-4-5-6-7-8-9-10-11-16-22-19(21)17-12-14-18(20)15-13-17/h12-15,20H,2-11,16H2,1H3 |
| CAS Registry Number |
2664-60-0 |
| EINECS |
220-195-8 |
| Molecular Structure |
|
| Density |
0.997g/cm3 |
| Boiling point |
423.8°C at 760 mmHg |
| Refractive index |
1.503 |
| Flash point |
164.6°C |
| Vapour Pressur |
8.77E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.; |