584-08-7 Potassium carbonate
| product Name |
Potassium carbonate |
| Synonyms |
Potassium carbonate anhydrous; Potassium carbonate hemihydrate; Potassiumcarbonate; Dipotassium carbonate; Carbonic acid, dipotassium salt; Carbonate Of Potash; Salt of tartar; alt of wormwood; Pearl ash; Potassium carbonate,anhydrous; Heavy potassium carbonate |
| Molecular Formula |
K2CO3 |
| Molecular Weight |
138.2066 |
| InChI |
InChI=1/CH2O3.2K.2H/c2-1(3)4;;;;/h(H2,2,3,4);;;;/p-2/rCH2O3.2HK/c2-1(3)4;;/h(H2,2,3,4);2*1H/p-2 |
| CAS Registry Number |
584-08-7 |
| EINECS |
209-529-3 |
| Molecular Structure |
|
| Melting point |
891℃ |
| Water solubility |
1120 g/L (20℃) |
| Hazard Symbols |
Xn:Harmful; |
| Risk Codes |
R22:;
R36/37/38:; |
| Safety Description |
S26:;
S37/39:; |
|
|
|