585-99-9 D-(+)-MELIBIOSE
| product Name |
D-(+)-MELIBIOSE |
| Molecular Formula |
C12H22O11 |
| Molecular Weight |
342.2965 |
| InChI |
InChI=1/C12H22O11/c13-1-3-5(14)8(17)10(19)12(23-3)21-2-4-6(15)7(16)9(18)11(20)22-4/h3-20H,1-2H2/t3-,4-,5+,6-,7+,8+,9-,10-,11?,12+/m1/s1 |
| CAS Registry Number |
585-99-9 |
| EINECS |
209-568-6 |
| Molecular Structure |
|
| Density |
1.76g/cm3 |
| Melting point |
182℃ |
| Boiling point |
662.8°C at 760 mmHg |
| Refractive index |
1.652 |
| Flash point |
354.6°C |
| Vapour Pressur |
2.18E-20mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.; |
|
|