|
Calcium 2-oxoglutarate Basic information Introduction Calcium alpha-ketoglutarate (Ca-AKG) is a compound that has sparked significant interest in the health and wellness community for its multifaceted benefits. As a crucial player in the Krebs cycle, also known as the citric acid cycle, Ca-AKG is vital for energy production at the cellular level. Its role extends beyond mere energy production, influencing areas such as longevity, hair health, and bone density. This has led to its growing popularity as a dietary supplement, with many seeking to harness its potential to enhance their overall well-being. What is Ca-AKG?Calcium alpha-ketoglutarate (Ca-AKG) is a salt form of alpha-ketoglutaric acid, a key organic acid involved in the Krebs cycle. This metabolic pathway is essential for energy production, as it is responsible for converting nutrients into ATP (adenosine triphosphate), the energy currency of cells. Ca-AKG plays a pivotal role in this process, facilitating the efficient transfer of energy and contributing to overall cellular health. Ca-AKG BenefitsCa-AKG is a supplement with potential benefits for your bones, energy, skin, and muscles. The evidence comes from both human and animal studies. While it shows promise for improving health in various areas, the science is still evolving. Animal research has laid a good foundation, but more human studies are needed to fully understand how Ca-AKG works and its full benefits. This brief look at Ca-AKG highlights the importance of ongoing research to confirm its effectiveness and safety for long-term use. Energy Production and Fatigue ReductionCa-AKG is at the heart of how our bodies create energy. It plays a vital role in the Krebs cycle, which is a major process for making energy inside our cells. Ca-AKG helps turn the food we eat into adenosine triphosphate (ATP), which is like fuel for our cells. This process is especially important for parts of our body that need a lot of energy, like our heart and muscles. By helping to produce more ATP, Ca-AKG can help us feel more energetic and improve our endurance, making it easier to stay active and healthy. Research Context: Early research in animal models suggests improvements in energy metabolism, with limited but emerging studies in humans indicating potential benefits for energy and endurance. May Help Reduce InflammationCa-AKG may help reduce systemic inflammation by regulating cytokine production, crucial molecules in the body’s inflammatory response. This regulation is significant as chronic inflammation is linked to conditions like metabolic syndrome and diabetes. Research supports Ca-AKG’s role in lowering inflammatory markers, highlighting its potential in managing inflammation-related diseases. |
| Product Name: | Calcium 2-oxoglutarate |
| Synonyms: | ALPHA-KETOGLUTARATE CALCIUM MONOHYDRATE;A-KETOGLUTARIC ACID, CALCIUM SALT, MONOHYDRATE;Calcium 2-oxoglutarate;Pentanedioic Acid ,2-oxo-,Calcium Salt;α-Ketoglutaric acid calcium salt;2-Oxopentanedioic acid calcium salt;Calcium 2-oxopentanedioate;Ca-ketoglutarate |
| CAS: | 71686-01-6 |
| MF: | C5H8CaO5 |
| MW: | 188.19 |
| EINECS: | 275-843-2 |
| Product Categories: | |
| Mol File: | 71686-01-6.mol |
| Calcium 2-oxoglutarate Chemical Properties |
| Melting point | >300°C (not melting) |
| storage temp. | -20°C, Hygroscopic |
| solubility | Aqueous Acid (Slightly), Water (Slightly, Heated, Sonicated) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Water: Insoluble |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C5H6O5.Ca.2H/c6-3(5(9)10)1-2-4(7)8;;;/h1-2H2,(H,7,8)(H,9,10);;; |
| InChIKey | YWFUOMFSJDJVPT-UHFFFAOYSA-N |
| SMILES | C(=O)(C(=O)O)CCC(=O)O.[Ca] |
| CAS DataBase Reference | 71686-01-6(CAS DataBase Reference) |
| Safety Information |
| Calcium 2-oxoglutarate Usage And Synthesis |
| Description | Calcium 2-oxoglutarate is a reversible tyrosinase inhibitor, an intermediate in the production of ATP or GTP in the Krebs cycle, and a major carbon skeleton for nitrogen assimilation reactions. It has a variety of biological roles and can be used as a precursor for the synthesis of glutamate, an enzyme involved in the synthesis of amino acids and fatty acids, involved in the transcriptional regulation of cells and influencing plant metabolism, among other roles. Recent studies have demonstrated that mitochondria-mediated calcium 2-oxoglutarate in the rat heart is capable of controlling the formation of aspartic acid. |
| Uses | Calcium 2-Oxoglutarate helps stabilie redox homeostasis and helps improve arterial elasticity. |
| Application | Calcium 2-oxoglutarate is the Calcium salt form of 2-oxoglutarate. 2-oxoglutarate is naturally found in organisms and is a well-known intermediate in the production of ATP or GTP in the Krebs cycle. |
| Biological Activity | Calcium 2-oxoglutarate is an intermediate in the production of ATP or GTP in the Krebs cycle. It also acts as the major carbon skeleton for nitrogen-assimilatory reactions. Calcium 2-oxoglutarate is a reversible inhibitor of tyrosinase (IC50=15 mM). |