LEADER BIOCHEMICAL GROUP
Inquiry: info@leader-biogroup.com
Hot Line: +86-029-68895030
+86-029-68569962
Fax : +86-029-68569961
| Polyvinylpyrrolidone Chemical Properties |
| Melting point | >300 °C |
| Boiling point | 90-93 °C |
| density | 1,69 g/cm3 |
| storage temp. | 2-8°C |
| solubility | H2O: soluble100mg/mL |
| form | powder |
| color | White to yellow-white |
| PH | 3.0-5.0 |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| Merck | 14,7697 |
| Stability: | Stable. Incompatible with strong oxidizing agents. Light sensitive. Hygroscopic. |
| InChI | InChI=1S/C8H15NO/c1-3-7(2)9-6-4-5-8(9)10/h7H,3-6H2,1-2H3 |
| InChIKey | FAAHNQAYWKTLFD-UHFFFAOYSA-N |
| SMILES | N1(C(C)CC)C(=O)CCC1 |
| IARC | 3 (Vol. 19, Sup 7, 71) 1987 |
| EPA Substance Registry System | Polyvinylpyrrolidone (9003-39-8) |
| Safety Information |
| Safety Statements | 22-24/25 |
| WGK Germany | 1 |
| RTECS | TR8370000 |
| Autoignition Temperature | 440 °C |
| TSCA | Yes |
| HS Code | 39059990 |
| Hazardous Substances Data | 9003-39-8(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: > 2000 mg/kg |