Inquiry email: info@leader-biogroup.com
Hot Line +86-029-68895030
+86-029-68569961
+86-029-68569962
Fax +86-029-68895030
| product Name |
N-Ethyl-2-phenylindole |
| Synonyms |
1-Ethyl-2-phenylindole; 1-ethyl-2-phenyl-1H-indole |
| Molecular Formula |
C16H15N |
| Molecular Weight |
221.297 |
| InChI |
InChI=1/C16H15N/c1-2-17-15-11-7-6-10-14(15)12-16(17)13-8-4-3-5-9-13/h3-12H,2H2,1H3 |
| CAS Registry Number |
13228-39-2 |
| EINECS |
236-199-8 |
| Molecular Structure |
|
| Density |
1.03g/cm3 |
| Boiling point |
390.6°C at 760 mmHg |
| Refractive index |
1.59 |
| Flash point |
190°C |
| Vapour Pressur |
5.91E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.; |