Inquiry email: info@leader-biogroup.com
Hot Line +86-029-68895030
+86-029-68569961
+86-029-68569962
Fax +86-029-68895030
| product Name |
1-Adamantanamine sulfate |
| Synonyms |
1-Aminoadamantansulfate; Amantadine Sulphate; Amantadine Sulfate; tricyclo[3.3.1.1~3,7~]decan-1-amine sulfate (2:1); tricyclo[3.3.1.1~3,7~]decan-1-amine sulfate |
| Molecular Formula |
C10H19NO4S |
| Molecular Weight |
249.3272 |
| InChI |
InChI=1/C10H17N.H2O4S/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-5(2,3)4/h7-9H,1-6,11H2;(H2,1,2,3,4) |
| CAS Registry Number |
31377-23-8 |
| EINECS |
250-604-5 |
| Molecular Structure |
|
| Melting point |
300℃ |
| Boiling point |
225.7°C at 760 mmHg |
| Flash point |
96°C |
| Vapour Pressur |
0.0852mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.; |