Inquiry email: info@leader-biogroup.com
Hot Line +86-029-68895030
+86-029-68569961
+86-029-68569962
Fax +86-029-68895030
| product Name |
Oxamic acid, sodium salt |
| Synonyms |
oxamic acid sodium; Sodium oxamate; sodium amino(oxo)acetate; aminooxo-aceticacimonosodiumsalt; Oxamic Acid Sodium Salt |
| Molecular Formula |
C2H2NNaO3 |
| Molecular Weight |
111.0319 |
| InChI |
InChI=1/C2H3NO3.Na/c3-1(4)2(5)6;/h(H2,3,4)(H,5,6);/q;+1/p-1 |
| CAS Registry Number |
565-73-1 |
| EINECS |
209-290-5 |
| Molecular Structure |
|
| Melting point |
300℃ |
| Boiling point |
306.3°C at 760 mmHg |
| Flash point |
139°C |
| Vapour Pressur |
0.000177mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.; |