Inquiry email: info@leader-biogroup.com
Hot Line +86-029-68895030
+86-029-68569961
+86-029-68569962
Fax +86-029-68895030
553-17-3 bis(2-phenyl) carbonate| product Name | bis(2-phenyl) carbonate |
|---|
| Synonyms | diguaiacyl carbonate; guaiacyl carbonate; Guaiacol carbonate | | Molecular Formula | C15H14O5 | | Molecular Weight | 274.2687 | | InChI | InChI=1/C15H14O5/c1-17-11-7-3-5-9-13(11)19-15(16)20-14-10-6-4-8-12(14)18-2/h3-10H,1-2H3 | | CAS Registry Number | 553-17-3 | | EINECS | 209-034-2 | | Molecular Structure |  | | Density | 1.208g/cm3 | | Boiling point | 392.6°C at 760 mmHg | | Refractive index | 1.552 | | Flash point | 173.7°C | | Vapour Pressur | 2.27E-06mmHg at 25°C | | Hazard Symbols | | | Risk Codes | | | Safety Description | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
|
|
|