Inquiry email: info@leader-biogroup.com
Hot Line +86-029-68895030
+86-029-68569961
+86-029-68569962
Fax +86-029-68895030
2628-17-3 4-Vinylphenol
| product Name |
4-Vinylphenol |
| Synonyms |
4-Hydroxystyrene; p-Vinylphenol; 4'-Hydroxystyrene |
| Molecular Formula |
C8H8O |
| Molecular Weight |
120.15 |
| InChI |
InChI=1/C8H8O/c1-2-7-3-5-8(9)6-4-7/h2-6,9H,1H2 |
| CAS Registry Number |
2628-17-3 |
| EINECS |
220-103-6 |
| Molecular Structure |
|
| Melting point |
73℃ |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.; |
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.; |
|